3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile
Catalog No: FT-0678320
CAS No: 757978-11-3
- Chemical Name: 3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile
- Molecular Formula: C8H4IN3
- Molecular Weight: 269.04
- InChI Key: YLXANOLQQIUJNO-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4IN3/c9-7-4-12-8-6(7)1-5(2-10)3-11-8/h1,3-4H,(H,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 269.042 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 757978-11-3 |
| Bolling_Point: | N/A |
| Product_Name: | 3-Iodo-1H-pyrrolo[2,3-b]pyridine-5-carbonitrile |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C8H4IN3 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.09 |
| Refractive_Index: | 1.789 |
| FW: | 269.042 |
| PSA: | 52.47000 |
| MF: | C8H4IN3 |
| Exact_Mass: | 268.944977 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302 + H312 + H332-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)